C19H38O11 — CID 161390165
methyl 3-[2,2-bis(3-hydroxypropoxymethyl)-3-(3-methoxy-3-oxopropoxy)propoxy]propanoate;hydrate (PubChem CID 161390165) has the molecular formula C19H38O11 and a molecular weight of 442.50 g/mol. Its IUPAC name is methyl 3-[2,2-bis(3-hydroxypropoxymethyl)-3-(3-methoxy-3-oxopropoxy)propoxy]propanoate;hydrate.
| Compound Name | methyl 3-[2,2-bis(3-hydroxypropoxymethyl)-3-(3-methoxy-3-oxopropoxy)propoxy]propanoate;hydrate |
|---|---|
| PubChem CID | 161390165 |
| Molecular Formula | C19H38O11 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | methyl 3-[2,2-bis(3-hydroxypropoxymethyl)-3-(3-methoxy-3-oxopropoxy)propoxy]propanoate;hydrate |
| SMILES | COC(=O)CCOCC(COCCCO)(COCCCO)COCCC(=O)OC.O |
| InChI | InChI=1S/C19H36O10.H2O/c1-24-17(22)5-11-28-15-19(13-26-9-3-7-20,14-27-10-4-8-21)16-29-12-6-18(23)25-2;/h20-21H,3-16H2,1-2H3;1H2 |
| InChIKey | LCUXGQDXQONQOZ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 161.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|