C12H20K2O4 — CID 140613543
dipotassium;2-(6,6-dimethylheptyl)propanedioate (PubChem CID 140613543) has the molecular formula C12H20K2O4 and a molecular weight of 306.48 g/mol. Its IUPAC name is dipotassium;2-(6,6-dimethylheptyl)propanedioate.
| Compound Name | dipotassium;2-(6,6-dimethylheptyl)propanedioate |
|---|---|
| PubChem CID | 140613543 |
| Molecular Formula | C12H20K2O4 |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | dipotassium;2-(6,6-dimethylheptyl)propanedioate |
| SMILES | CC(C)(C)CCCCCC(C(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C12H22O4.2K/c1-12(2,3)8-6-4-5-7-9(10(13)14)11(15)16;;/h9H,4-8H2,1-3H3,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | ADIBIJQVEMOHOR-UHFFFAOYSA-L |
| XLogP | -5.89 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|