C15H33NO3 — CID 155776897
azanium 2-(2-hydroxyethyl)-10,10-dimethylundecanoate (PubChem CID 155776897) has the molecular formula C15H33NO3 and a molecular weight of 275.43 g/mol. Its IUPAC name is azanium 2-(2-hydroxyethyl)-10,10-dimethylundecanoate.
| Compound Name | azanium 2-(2-hydroxyethyl)-10,10-dimethylundecanoate |
|---|---|
| PubChem CID | 155776897 |
| Molecular Formula | C15H33NO3 |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | azanium 2-(2-hydroxyethyl)-10,10-dimethylundecanoate |
| SMILES | CC(C)(C)CCCCCCCC(CCO)C(=O)[O-].[NH4+] |
| InChI | InChI=1S/C15H30O3.H3N/c1-15(2,3)11-8-6-4-5-7-9-13(10-12-16)14(17)18;/h13,16H,4-12H2,1-3H3,(H,17,18);1H3 |
| InChIKey | JRNQGXZELKXGJF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|