C14H28O4S — CID 22743191
5-(5-hydroperoxy-4,4-dimethylpentyl)sulfanyl-2,2-dimethylpentanoic acid (PubChem CID 22743191) has the molecular formula C14H28O4S and a molecular weight of 292.44 g/mol. Its IUPAC name is 5-(5-hydroperoxy-4,4-dimethylpentyl)sulfanyl-2,2-dimethylpentanoic acid.
| Compound Name | 5-(5-hydroperoxy-4,4-dimethylpentyl)sulfanyl-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 22743191 |
| Molecular Formula | C14H28O4S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 5-(5-hydroperoxy-4,4-dimethylpentyl)sulfanyl-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(CCCSCCCC(C)(C)C(=O)O)COO |
| InChI | InChI=1S/C14H28O4S/c1-13(2,11-18-17)7-5-9-19-10-6-8-14(3,4)12(15)16/h17H,5-11H2,1-4H3,(H,15,16) |
| InChIKey | QGWQKFFTCVVEIJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|