C24H38O4S2 — CID 141186602
6-[3-(4,4-dimethyl-5-oxo-5-phenoxypentyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoic acid (PubChem CID 141186602) has the molecular formula C24H38O4S2 and a molecular weight of 454.70 g/mol. Its IUPAC name is 6-[3-(4,4-dimethyl-5-oxo-5-phenoxypentyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoic acid.
| Compound Name | 6-[3-(4,4-dimethyl-5-oxo-5-phenoxypentyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoic acid |
|---|---|
| PubChem CID | 141186602 |
| Molecular Formula | C24H38O4S2 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 6-[3-(4,4-dimethyl-5-oxo-5-phenoxypentyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoic acid |
| SMILES | CC(C)(CCCSCCCSCCCC(C)(C)C(=O)Oc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C24H38O4S2/c1-23(2,19-21(25)26)13-8-15-29-17-10-18-30-16-9-14-24(3,4)22(27)28-20-11-6-5-7-12-20/h5-7,11-12H,8-10,13-19H2,1-4H3,(H,25,26) |
| InChIKey | JKPSHBARKQPLHA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|