C14H21NO2 — CID 174861843
phenyl 4-(dimethylamino)-2,2-dimethylbutanoate (PubChem CID 174861843) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is phenyl 4-(dimethylamino)-2,2-dimethylbutanoate.
| Compound Name | phenyl 4-(dimethylamino)-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 174861843 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | phenyl 4-(dimethylamino)-2,2-dimethylbutanoate |
| SMILES | CN(C)CCC(C)(C)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-14(2,10-11-15(3)4)13(16)17-12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3 |
| InChIKey | UDMRLQXSJOBEKV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|