C16H24ClNO4S2 — CID 22151564
5-[3-[(4-chlorophenyl)sulfonylamino]propylsulfanyl]-2,2-dimethylpentanoic acid (PubChem CID 22151564) has the molecular formula C16H24ClNO4S2 and a molecular weight of 393.96 g/mol. Its IUPAC name is 5-[3-[(4-chlorophenyl)sulfonylamino]propylsulfanyl]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[3-[(4-chlorophenyl)sulfonylamino]propylsulfanyl]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 22151564 |
| Molecular Formula | C16H24ClNO4S2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 5-[3-[(4-chlorophenyl)sulfonylamino]propylsulfanyl]-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(CCCSCCCNS(=O)(=O)c1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C16H24ClNO4S2/c1-16(2,15(19)20)9-3-11-23-12-4-10-18-24(21,22)14-7-5-13(17)6-8-14/h5-8,18H,3-4,9-12H2,1-2H3,(H,19,20) |
| InChIKey | MIBAFSGXCSBGEF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|