C11H22O4S — CID 106714509
6-(2,3-dihydroxypropylsulfanyl)-2,2-dimethylhexanoic acid (PubChem CID 106714509) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is 6-(2,3-dihydroxypropylsulfanyl)-2,2-dimethylhexanoic acid.
| Compound Name | 6-(2,3-dihydroxypropylsulfanyl)-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 106714509 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 6-(2,3-dihydroxypropylsulfanyl)-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCSCC(O)CO)C(=O)O |
| InChI | InChI=1S/C11H22O4S/c1-11(2,10(14)15)5-3-4-6-16-8-9(13)7-12/h9,12-13H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | DWIPQOUTBLOKOF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|