C15H29NO4S — CID 79671932
ethyl 2-(cyclopropylamino)-6-(2,3-dihydroxypropylsulfanyl)-2-methylhexanoate (PubChem CID 79671932) has the molecular formula C15H29NO4S and a molecular weight of 319.47 g/mol. Its IUPAC name is ethyl 2-(cyclopropylamino)-6-(2,3-dihydroxypropylsulfanyl)-2-methylhexanoate.
| Compound Name | ethyl 2-(cyclopropylamino)-6-(2,3-dihydroxypropylsulfanyl)-2-methylhexanoate |
|---|---|
| PubChem CID | 79671932 |
| Molecular Formula | C15H29NO4S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | ethyl 2-(cyclopropylamino)-6-(2,3-dihydroxypropylsulfanyl)-2-methylhexanoate |
| SMILES | CCOC(=O)C(C)(CCCCSCC(O)CO)NC1CC1 |
| InChI | InChI=1S/C15H29NO4S/c1-3-20-14(19)15(2,16-12-6-7-12)8-4-5-9-21-11-13(18)10-17/h12-13,16-18H,3-11H2,1-2H3 |
| InChIKey | NMHNILYGJDWKFH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|