C8H18N2O3S — CID 79670922
5-(2,3-dihydroxypropylsulfanyl)pentanehydrazide (PubChem CID 79670922) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropylsulfanyl)pentanehydrazide.
| Compound Name | 5-(2,3-dihydroxypropylsulfanyl)pentanehydrazide |
|---|---|
| PubChem CID | 79670922 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 5-(2,3-dihydroxypropylsulfanyl)pentanehydrazide |
| SMILES | NNC(=O)CCCCSCC(O)CO |
| InChI | InChI=1S/C8H18N2O3S/c9-10-8(13)3-1-2-4-14-6-7(12)5-11/h7,11-12H,1-6,9H2,(H,10,13) |
| InChIKey | OACBHHHODJCBPZ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|