C8H16N2O4S — CID 79681774
3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide (PubChem CID 79681774) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide.
| Compound Name | 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 79681774 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)CCSCC(O)CO |
| InChI | InChI=1S/C8H16N2O4S/c1-9-8(14)10-7(13)2-3-15-5-6(12)4-11/h6,11-12H,2-5H2,1H3,(H2,9,10,13,14) |
| InChIKey | XHDQDBXYMOWIHZ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|