About 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide
3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide (PubChem CID 79681774) has the molecular formula C8H16N2O4S
and a molecular weight of 236.29 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide.
Molecular Properties
| Compound Name | 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide |
| PubChem CID | 79681774 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)CCSCC(O)CO |
| InChI | InChI=1S/C8H16N2O4S/c1-9-8(14)10-7(13)2-3-15-5-6(12)4-11/h6,11-12H,2-5H2,1H3,(H2,9,10,13,14) |
| InChIKey | XHDQDBXYMOWIHZ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide?
The IUPAC name of 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide (CID 79681774) is 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide.
What is the SMILES notation for 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide?
The canonical SMILES for 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide is CNC(=O)NC(=O)CCSCC(O)CO.
What is the InChIKey of 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide?
The InChIKey is XHDQDBXYMOWIHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O4S/c1-9-8(14)10-7(13)2-3-15-5-6(12)4-11/h6,11-12H,2-5H2,1H3,(H2,9,10,13,14).
What are the key properties of 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide?
3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide has a molecular weight of 236.29 g/mol, XLogP of -1.08, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroxypropylsulfanyl)-N-(methylcarbamoyl)propanamide is sourced from PubChem (CID 79681774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).