C10H18N2O3S — CID 79682818
N-(2-cyanoethyl)-3-(2,3-dihydroxypropylsulfanyl)-N-methylpropanamide (PubChem CID 79682818) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-(2,3-dihydroxypropylsulfanyl)-N-methylpropanamide.
| Compound Name | N-(2-cyanoethyl)-3-(2,3-dihydroxypropylsulfanyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 79682818 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(2-cyanoethyl)-3-(2,3-dihydroxypropylsulfanyl)-N-methylpropanamide |
| SMILES | CN(CCC#N)C(=O)CCSCC(O)CO |
| InChI | InChI=1S/C10H18N2O3S/c1-12(5-2-4-11)10(15)3-6-16-8-9(14)7-13/h9,13-14H,2-3,5-8H2,1H3 |
| InChIKey | RSHXXAODZKWGPS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|