C14H20O5S — CID 10709356
(4-methoxyphenyl)methyl 3-(2,3-dihydroxypropylsulfanyl)propanoate (PubChem CID 10709356) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 3-(2,3-dihydroxypropylsulfanyl)propanoate.
| Compound Name | (4-methoxyphenyl)methyl 3-(2,3-dihydroxypropylsulfanyl)propanoate |
|---|---|
| PubChem CID | 10709356 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (4-methoxyphenyl)methyl 3-(2,3-dihydroxypropylsulfanyl)propanoate |
| SMILES | COc1ccc(COC(=O)CCSCC(O)CO)cc1 |
| InChI | InChI=1S/C14H20O5S/c1-18-13-4-2-11(3-5-13)9-19-14(17)6-7-20-10-12(16)8-15/h2-5,12,15-16H,6-10H2,1H3 |
| InChIKey | OUINEUHDKMOLBJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|