C14H20O6S — CID 139989016
6-[(4-methoxyphenyl)methoxy]-6-oxohexane-1-sulfonic acid (PubChem CID 139989016) has the molecular formula C14H20O6S and a molecular weight of 316.37 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methoxy]-6-oxohexane-1-sulfonic acid.
| Compound Name | 6-[(4-methoxyphenyl)methoxy]-6-oxohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 139989016 |
| Molecular Formula | C14H20O6S |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 6-[(4-methoxyphenyl)methoxy]-6-oxohexane-1-sulfonic acid |
| SMILES | COc1ccc(COC(=O)CCCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H20O6S/c1-19-13-8-6-12(7-9-13)11-20-14(15)5-3-2-4-10-21(16,17)18/h6-9H,2-5,10-11H2,1H3,(H,16,17,18) |
| InChIKey | UCSACRIYGLCRIA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|