C13H16F12O — CID 118422545
1,1,2,2,3,3,4-heptafluoro-4-methyl-1-(1,1,1,2,2-pentafluoro-3-methylpentan-3-yl)oxyhexane (PubChem CID 118422545) has the molecular formula C13H16F12O and a molecular weight of 416.25 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluoro-4-methyl-1-(1,1,1,2,2-pentafluoro-3-methylpentan-3-yl)oxyhexane.
| Compound Name | 1,1,2,2,3,3,4-heptafluoro-4-methyl-1-(1,1,1,2,2-pentafluoro-3-methylpentan-3-yl)oxyhexane |
|---|---|
| PubChem CID | 118422545 |
| Molecular Formula | C13H16F12O |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1,1,2,2,3,3,4-heptafluoro-4-methyl-1-(1,1,1,2,2-pentafluoro-3-methylpentan-3-yl)oxyhexane |
| SMILES | CCC(C)(F)C(F)(F)C(F)(F)C(F)(F)OC(C)(CC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H16F12O/c1-5-7(3,14)9(15,16)11(19,20)13(24,25)26-8(4,6-2)10(17,18)12(21,22)23/h5-6H2,1-4H3 |
| InChIKey | AVOXIEGDUMHMSA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|