C12H22F4 — CID 88578867
4,4,5,5-tetrafluoro-3,3,6,6-tetramethyloctane (PubChem CID 88578867) has the molecular formula C12H22F4 and a molecular weight of 242.30 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoro-3,3,6,6-tetramethyloctane.
| Compound Name | 4,4,5,5-tetrafluoro-3,3,6,6-tetramethyloctane |
|---|---|
| PubChem CID | 88578867 |
| Molecular Formula | C12H22F4 |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 4,4,5,5-tetrafluoro-3,3,6,6-tetramethyloctane |
| SMILES | CCC(C)(C)C(F)(F)C(F)(F)C(C)(C)CC |
| InChI | InChI=1S/C12H22F4/c1-7-9(3,4)11(13,14)12(15,16)10(5,6)8-2/h7-8H2,1-6H3 |
| InChIKey | SBWFBNXDSPSMNE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|