C9H14F6 — CID 23236514
1,1,1-trifluoro-3-(trifluoromethyl)octane (PubChem CID 23236514) has the molecular formula C9H14F6 and a molecular weight of 236.20 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(trifluoromethyl)octane.
| Compound Name | 1,1,1-trifluoro-3-(trifluoromethyl)octane |
|---|---|
| PubChem CID | 23236514 |
| Molecular Formula | C9H14F6 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1,1,1-trifluoro-3-(trifluoromethyl)octane |
| SMILES | CCCCCC(CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F6/c1-2-3-4-5-7(9(13,14)15)6-8(10,11)12/h7H,2-6H2,1H3 |
| InChIKey | ONGHBSVHPJEFSC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|