C12H12F13I — CID 14270442
1,1,1,2,2,3,3-heptafluoro-6-iodo-4,4-bis(trifluoromethyl)decane (PubChem CID 14270442) has the molecular formula C12H12F13I and a molecular weight of 530.11 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-6-iodo-4,4-bis(trifluoromethyl)decane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-6-iodo-4,4-bis(trifluoromethyl)decane |
|---|---|
| PubChem CID | 14270442 |
| Molecular Formula | C12H12F13I |
| Molecular Weight | 530.11 g/mol |
| Exact Mass | 529.98 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-6-iodo-4,4-bis(trifluoromethyl)decane |
| SMILES | CCCCC(I)CC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F13I/c1-2-3-4-6(26)5-7(10(17,18)19,11(20,21)22)8(13,14)9(15,16)12(23,24)25/h6H,2-5H2,1H3 |
| InChIKey | HVZLGRLQYFSTSP-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.11 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|