C15H15F17 — CID 91148489
9-ethyl-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-methyldodecane (PubChem CID 91148489) has the molecular formula C15H15F17 and a molecular weight of 518.25 g/mol. Its IUPAC name is 9-ethyl-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-methyldodecane.
| Compound Name | 9-ethyl-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-methyldodecane |
|---|---|
| PubChem CID | 91148489 |
| Molecular Formula | C15H15F17 |
| Molecular Weight | 518.25 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 9-ethyl-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-methyldodecane |
| SMILES | CCC(CC(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H15F17/c1-4-7(5-6(2)3)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h6-7H,4-5H2,1-3H3 |
| InChIKey | MNVAOFFESBJLCY-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.25 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|