C7H6F10O2 — CID 98117480
(2S)-3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-methylpropan-1-ol (PubChem CID 98117480) has the molecular formula C7H6F10O2 and a molecular weight of 312.10 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-methylpropan-1-ol.
| Compound Name | (2S)-3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 98117480 |
| Molecular Formula | C7H6F10O2 |
| Molecular Weight | 312.10 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-methylpropan-1-ol |
| SMILES | C[C@@](CO)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F10O2/c1-3(2-18,5(10,11)12)19-7(16,17)4(8,9)6(13,14)15/h18H,2H2,1H3/t3-/m0/s1 |
| InChIKey | KEQUAHCFYVYPMN-VKHMYHEASA-N |
| XLogP | 3.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|