C5F11IO — CID 96560026
1,1,1,2,2,3,3-heptafluoro-3-[(1S)-1,2,2,2-tetrafluoro-1-iodoethoxy]propane (PubChem CID 96560026) has the molecular formula C5F11IO and a molecular weight of 411.94 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-3-[(1S)-1,2,2,2-tetrafluoro-1-iodoethoxy]propane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-3-[(1S)-1,2,2,2-tetrafluoro-1-iodoethoxy]propane |
|---|---|
| PubChem CID | 96560026 |
| Molecular Formula | C5F11IO |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.88 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-3-[(1S)-1,2,2,2-tetrafluoro-1-iodoethoxy]propane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)O[C@@](F)(I)C(F)(F)F |
| InChI | InChI=1S/C5F11IO/c6-1(7,2(8,9)10)4(14,15)18-5(16,17)3(11,12)13/t5-/m0/s1 |
| InChIKey | WXGLHUFWWLOFCN-YFKPBYRVSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|