C7H8F12O — CID 160879773
1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propane;methane (PubChem CID 160879773) has the molecular formula C7H8F12O and a molecular weight of 336.12 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propane;methane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propane;methane |
|---|---|
| PubChem CID | 160879773 |
| Molecular Formula | C7H8F12O |
| Molecular Weight | 336.12 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propane;methane |
| SMILES | C.C.FC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5F12O.2CH4/c6-1(7,2(8,9)10)4(14,15)18-5(16,17)3(11,12)13;;/h;2*1H4 |
| InChIKey | SMWOJJDNPVKVSW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.12 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|