C7H7F9O — CID 155372956
1,1,2,2,3,3-hexafluoro-1-(trifluoromethoxy)hexane (PubChem CID 155372956) has the molecular formula C7H7F9O and a molecular weight of 278.11 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-1-(trifluoromethoxy)hexane.
| Compound Name | 1,1,2,2,3,3-hexafluoro-1-(trifluoromethoxy)hexane |
|---|---|
| PubChem CID | 155372956 |
| Molecular Formula | C7H7F9O |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-1-(trifluoromethoxy)hexane |
| SMILES | CCCC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C7H7F9O/c1-2-3-4(8,9)5(10,11)6(12,13)17-7(14,15)16/h2-3H2,1H3 |
| InChIKey | GXVQPGMOJJNJHQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|