C9H8F12O — CID 87670862
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorononan-1-ol (PubChem CID 87670862) has the molecular formula C9H8F12O and a molecular weight of 360.14 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorononan-1-ol.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorononan-1-ol |
|---|---|
| PubChem CID | 87670862 |
| Molecular Formula | C9H8F12O |
| Molecular Weight | 360.14 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorononan-1-ol |
| SMILES | CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)(F)F |
| InChI | InChI=1S/C9H8F12O/c1-2-3-4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h22H,2-3H2,1H3 |
| InChIKey | OFRIWKFVXCKVQB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.14 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|