C12H7F17 — CID 87394996
1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorododec-1-ene (PubChem CID 87394996) has the molecular formula C12H7F17 and a molecular weight of 474.15 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorododec-1-ene.
| Compound Name | 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorododec-1-ene |
|---|---|
| PubChem CID | 87394996 |
| Molecular Formula | C12H7F17 |
| Molecular Weight | 474.15 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorododec-1-ene |
| SMILES | CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C12H7F17/c1-2-3-6(16,17)8(20,21)10(24,25)12(28,29)11(26,27)9(22,23)7(18,19)4(13)5(14)15/h2-3H2,1H3 |
| InChIKey | ASJYUTAUBDPUBL-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.15 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|