C8H3F15O4 — CID 87104416
2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethanol (PubChem CID 87104416) has the molecular formula C8H3F15O4 and a molecular weight of 448.08 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethanol.
| Compound Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 87104416 |
| Molecular Formula | C8H3F15O4 |
| Molecular Weight | 448.08 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethanol |
| SMILES | OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H3F15O4/c9-2(10,1-24)25-5(16,17)6(18,19)27-8(22,23)7(20,21)26-4(14,15)3(11,12)13/h24H,1H2 |
| InChIKey | SFESMARWLHCUBQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.08 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|