C6H5F9O2 — CID 131727974
3,3,4,4-tetrafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butan-1-ol (PubChem CID 131727974) has the molecular formula C6H5F9O2 and a molecular weight of 280.09 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butan-1-ol.
| Compound Name | 3,3,4,4-tetrafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butan-1-ol |
|---|---|
| PubChem CID | 131727974 |
| Molecular Formula | C6H5F9O2 |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 3,3,4,4-tetrafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butan-1-ol |
| SMILES | OCCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F9O2/c7-3(8,1-2-16)5(12,13)17-6(14,15)4(9,10)11/h16H,1-2H2 |
| InChIKey | BSNAJMJWVRNFHM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|