C12H13F13O — CID 87061527
3,3,4,4,7,7,8,8,11,11,12,12,12-tridecafluorododecan-1-ol (PubChem CID 87061527) has the molecular formula C12H13F13O and a molecular weight of 420.21 g/mol. Its IUPAC name is 3,3,4,4,7,7,8,8,11,11,12,12,12-tridecafluorododecan-1-ol.
| Compound Name | 3,3,4,4,7,7,8,8,11,11,12,12,12-tridecafluorododecan-1-ol |
|---|---|
| PubChem CID | 87061527 |
| Molecular Formula | C12H13F13O |
| Molecular Weight | 420.21 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3,3,4,4,7,7,8,8,11,11,12,12,12-tridecafluorododecan-1-ol |
| SMILES | OCCC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F13O/c13-7(14,1-2-9(17,18)10(19,20)5-6-26)8(15,16)3-4-11(21,22)12(23,24)25/h26H,1-6H2 |
| InChIKey | ZSSGQKVHSWOMGP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.21 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|