C7H8F8O2 — CID 87287129
1-(1,1-difluoropropoxy)-1,1,2,2,3,3-hexafluoro-3-methoxypropane (PubChem CID 87287129) has the molecular formula C7H8F8O2 and a molecular weight of 276.12 g/mol. Its IUPAC name is 1-(1,1-difluoropropoxy)-1,1,2,2,3,3-hexafluoro-3-methoxypropane.
| Compound Name | 1-(1,1-difluoropropoxy)-1,1,2,2,3,3-hexafluoro-3-methoxypropane |
|---|---|
| PubChem CID | 87287129 |
| Molecular Formula | C7H8F8O2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 1-(1,1-difluoropropoxy)-1,1,2,2,3,3-hexafluoro-3-methoxypropane |
| SMILES | CCC(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC |
| InChI | InChI=1S/C7H8F8O2/c1-3-4(8,9)17-7(14,15)5(10,11)6(12,13)16-2/h3H2,1-2H3 |
| InChIKey | QKYGHEWODZLFRU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|