C6H2F13O4P — CID 87127911
[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(trifluoromethyl)pentan-3-yl] dihydrogen phosphate (PubChem CID 87127911) has the molecular formula C6H2F13O4P and a molecular weight of 416.03 g/mol. Its IUPAC name is [1,1,1,2,2,4,4,5,5,5-decafluoro-3-(trifluoromethyl)pentan-3-yl] dihydrogen phosphate.
| Compound Name | [1,1,1,2,2,4,4,5,5,5-decafluoro-3-(trifluoromethyl)pentan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87127911 |
| Molecular Formula | C6H2F13O4P |
| Molecular Weight | 416.03 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | [1,1,1,2,2,4,4,5,5,5-decafluoro-3-(trifluoromethyl)pentan-3-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H2F13O4P/c7-2(8,5(14,15)16)1(4(11,12)13,23-24(20,21)22)3(9,10)6(17,18)19/h(H2,20,21,22) |
| InChIKey | ROJFXIAWYMXLJD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.03 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|