C10H16F7O4P — CID 87919185
(4-ethyl-1,1,1,2,2,3,3-heptafluorooctan-4-yl) dihydrogen phosphate (PubChem CID 87919185) has the molecular formula C10H16F7O4P and a molecular weight of 364.19 g/mol. Its IUPAC name is (4-ethyl-1,1,1,2,2,3,3-heptafluorooctan-4-yl) dihydrogen phosphate.
| Compound Name | (4-ethyl-1,1,1,2,2,3,3-heptafluorooctan-4-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 87919185 |
| Molecular Formula | C10H16F7O4P |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (4-ethyl-1,1,1,2,2,3,3-heptafluorooctan-4-yl) dihydrogen phosphate |
| SMILES | CCCCC(CC)(OP(=O)(O)O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H16F7O4P/c1-3-5-6-7(4-2,21-22(18,19)20)8(11,12)9(13,14)10(15,16)17/h3-6H2,1-2H3,(H2,18,19,20) |
| InChIKey | QBGWIPXPURUGPK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|