C16H20F19O4P — CID 175293691
1-fluorooctane;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecafluorooctane;phosphoric acid (PubChem CID 175293691) has the molecular formula C16H20F19O4P and a molecular weight of 668.27 g/mol. Its IUPAC name is 1-fluorooctane;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecafluorooctane;phosphoric acid.
| Compound Name | 1-fluorooctane;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecafluorooctane;phosphoric acid |
|---|---|
| PubChem CID | 175293691 |
| Molecular Formula | C16H20F19O4P |
| Molecular Weight | 668.27 g/mol |
| Exact Mass | 668.08 |
| IUPAC Name | 1-fluorooctane;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecafluorooctane;phosphoric acid |
| SMILES | CCCCCCCCF.FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=P(O)(O)O |
| InChI | InChI=1S/C8F18.C8H17F.H3O4P/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26;1-2-3-4-5-6-7-8-9;1-5(2,3)4/h;2-8H2,1H3;(H3,1,2,3,4) |
| InChIKey | NZDUAQGYCXWIFJ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.27 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|