C6H5F10O4P — CID 87463098
(1,1,1,2,2,4,4,5,5,5-decafluoro-3-methylpentan-3-yl) dihydrogen phosphate (PubChem CID 87463098) has the molecular formula C6H5F10O4P and a molecular weight of 362.06 g/mol. Its IUPAC name is (1,1,1,2,2,4,4,5,5,5-decafluoro-3-methylpentan-3-yl) dihydrogen phosphate.
| Compound Name | (1,1,1,2,2,4,4,5,5,5-decafluoro-3-methylpentan-3-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 87463098 |
| Molecular Formula | C6H5F10O4P |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | (1,1,1,2,2,4,4,5,5,5-decafluoro-3-methylpentan-3-yl) dihydrogen phosphate |
| SMILES | CC(OP(=O)(O)O)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F10O4P/c1-2(20-21(17,18)19,3(7,8)5(11,12)13)4(9,10)6(14,15)16/h1H3,(H2,17,18,19) |
| InChIKey | SRSWWFJJLHBAQZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|