C6H6F9O4P — CID 87764852
1,1,2,2,3,3,4,4,5-nonafluorohexyl dihydrogen phosphate (PubChem CID 87764852) has the molecular formula C6H6F9O4P and a molecular weight of 344.07 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5-nonafluorohexyl dihydrogen phosphate.
| Compound Name | 1,1,2,2,3,3,4,4,5-nonafluorohexyl dihydrogen phosphate |
|---|---|
| PubChem CID | 87764852 |
| Molecular Formula | C6H6F9O4P |
| Molecular Weight | 344.07 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5-nonafluorohexyl dihydrogen phosphate |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OP(=O)(O)O |
| InChI | InChI=1S/C6H6F9O4P/c1-2(7)3(8,9)4(10,11)5(12,13)6(14,15)19-20(16,17)18/h2H,1H3,(H2,16,17,18) |
| InChIKey | VIDYWOZJQWQONR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.07 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|