C16H9F26O4P — CID 152762188
[1,1,2,3,3,4,4,5,5,6,10,10,10-tridecafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)decyl] dihydrogen phosphate (PubChem CID 152762188) has the molecular formula C16H9F26O4P and a molecular weight of 790.17 g/mol. Its IUPAC name is [1,1,2,3,3,4,4,5,5,6,10,10,10-tridecafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)decyl] dihydrogen phosphate.
| Compound Name | [1,1,2,3,3,4,4,5,5,6,10,10,10-tridecafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)decyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 152762188 |
| Molecular Formula | C16H9F26O4P |
| Molecular Weight | 790.17 g/mol |
| Exact Mass | 789.98 |
| IUPAC Name | [1,1,2,3,3,4,4,5,5,6,10,10,10-tridecafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)decyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(F)(F)C(F)(C(F)(F)C(F)(F)C(F)(F)C(F)CCCC(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H9F26O4P/c17-4(2-1-3-5(18,19)20)6(21,22)8(24,25)9(26,27)7(23,16(41,42)46-47(43,44)45)10(28,29)11(30,31)12(32,33)13(34,35)14(36,37)15(38,39)40/h4H,1-3H2,(H2,43,44,45) |
| InChIKey | DHCGNXDXGPMUER-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.17 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|