C10H7F17OS — CID 88736255
[2,2,3,3,4,4,5,5,6,10,10,10-dodecafluoro-1-(tetrafluoro-λ6-sulfanylidene)decyl] hypofluorite (PubChem CID 88736255) has the molecular formula C10H7F17OS and a molecular weight of 498.20 g/mol. Its IUPAC name is [2,2,3,3,4,4,5,5,6,10,10,10-dodecafluoro-1-(tetrafluoro-λ6-sulfanylidene)decyl] hypofluorite.
| Compound Name | [2,2,3,3,4,4,5,5,6,10,10,10-dodecafluoro-1-(tetrafluoro-λ6-sulfanylidene)decyl] hypofluorite |
|---|---|
| PubChem CID | 88736255 |
| Molecular Formula | C10H7F17OS |
| Molecular Weight | 498.20 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | [2,2,3,3,4,4,5,5,6,10,10,10-dodecafluoro-1-(tetrafluoro-λ6-sulfanylidene)decyl] hypofluorite |
| SMILES | FOC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCCC(F)(F)F)=S(F)(F)(F)F |
| InChI | InChI=1S/C10H7F17OS/c11-4(2-1-3-6(12,13)14)7(15,16)9(19,20)10(21,22)8(17,18)5(28-23)29(24,25,26)27/h4H,1-3H2 |
| InChIKey | IWKPSOXGKIFFAC-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.20 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|