C9H7F15OS — CID 88735724
[2,2,3,3,4,4,5,9,9,9-decafluoro-1-(tetrafluoro-λ6-sulfanylidene)nonyl] hypofluorite (PubChem CID 88735724) has the molecular formula C9H7F15OS and a molecular weight of 448.19 g/mol. Its IUPAC name is [2,2,3,3,4,4,5,9,9,9-decafluoro-1-(tetrafluoro-λ6-sulfanylidene)nonyl] hypofluorite.
| Compound Name | [2,2,3,3,4,4,5,9,9,9-decafluoro-1-(tetrafluoro-λ6-sulfanylidene)nonyl] hypofluorite |
|---|---|
| PubChem CID | 88735724 |
| Molecular Formula | C9H7F15OS |
| Molecular Weight | 448.19 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | [2,2,3,3,4,4,5,9,9,9-decafluoro-1-(tetrafluoro-λ6-sulfanylidene)nonyl] hypofluorite |
| SMILES | FOC(C(F)(F)C(F)(F)C(F)(F)C(F)CCCC(F)(F)F)=S(F)(F)(F)F |
| InChI | InChI=1S/C9H7F15OS/c10-4(2-1-3-6(11,12)13)7(14,15)9(18,19)8(16,17)5(25-20)26(21,22,23)24/h4H,1-3H2 |
| InChIKey | WYWCKQXGIHTCNW-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.19 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|