C11H11F12LiO3S — CID 141492467
lithium 1,1,2,2,3,3,4,4,5,11,11,11-dodecafluoroundecane-1-sulfonate (PubChem CID 141492467) has the molecular formula C11H11F12LiO3S and a molecular weight of 458.19 g/mol. Its IUPAC name is lithium 1,1,2,2,3,3,4,4,5,11,11,11-dodecafluoroundecane-1-sulfonate.
| Compound Name | lithium 1,1,2,2,3,3,4,4,5,11,11,11-dodecafluoroundecane-1-sulfonate |
|---|---|
| PubChem CID | 141492467 |
| Molecular Formula | C11H11F12LiO3S |
| Molecular Weight | 458.19 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | lithium 1,1,2,2,3,3,4,4,5,11,11,11-dodecafluoroundecane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCCCCC(F)(F)F.[Li+] |
| InChI | InChI=1S/C11H12F12O3S.Li/c12-6(4-2-1-3-5-7(13,14)15)8(16,17)9(18,19)10(20,21)11(22,23)27(24,25)26;/h6H,1-5H2,(H,24,25,26);/q;+1/p-1 |
| InChIKey | BDAMYZGYMUICTB-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|