C27H27F30O3Si — CID 166065066
CID 166065066 (PubChem CID 166065066) has the molecular formula C27H27F30O3Si and a molecular weight of 997.54 g/mol.
| Compound Name | CID 166065066 |
|---|---|
| PubChem CID | 166065066 |
| Molecular Formula | C27H27F30O3Si |
| Molecular Weight | 997.54 g/mol |
| Exact Mass | 997.13 |
| IUPAC Name | — |
| SMILES | CO[Si](OC)OC(C(F)(F)C(F)(F)C(F)(F)C(F)CCCC(F)(F)F)(C(F)(F)C(F)(F)C(F)(F)C(F)CCCC(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)CCCC(F)(F)F |
| InChI | InChI=1S/C27H27F30O3Si/c1-58-61(59-2)60-21(25(52,53)22(46,47)18(40,41)12(28)6-3-9-15(31,32)33,26(54,55)23(48,49)19(42,43)13(29)7-4-10-16(34,35)36)27(56,57)24(50,51)20(44,45)14(30)8-5-11-17(37,38)39/h12-14H,3-11H2,1-2H3 |
| InChIKey | FVYQPKLNBPLZKV-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.54 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|