C5H2F11O3P — CID 87154822
1,1,1,2,2,3,4,4,5,5,5-undecafluoropentan-3-ylphosphonic acid (PubChem CID 87154822) has the molecular formula C5H2F11O3P and a molecular weight of 350.02 g/mol. Its IUPAC name is 1,1,1,2,2,3,4,4,5,5,5-undecafluoropentan-3-ylphosphonic acid.
| Compound Name | 1,1,1,2,2,3,4,4,5,5,5-undecafluoropentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 87154822 |
| Molecular Formula | C5H2F11O3P |
| Molecular Weight | 350.02 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | 1,1,1,2,2,3,4,4,5,5,5-undecafluoropentan-3-ylphosphonic acid |
| SMILES | O=P(O)(O)C(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H2F11O3P/c6-1(7,4(11,12)13)3(10,20(17,18)19)2(8,9)5(14,15)16/h(H2,17,18,19) |
| InChIKey | BFVHKXUMVWDRDS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.02 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|