C8H2F17O3P — CID 87155338
[1,1,2,2,3,3,4,5,5,6,6,6-dodecafluoro-4-(1,1,2,2,2-pentafluoroethyl)hexyl]phosphonic acid (PubChem CID 87155338) has the molecular formula C8H2F17O3P and a molecular weight of 500.04 g/mol. Its IUPAC name is [1,1,2,2,3,3,4,5,5,6,6,6-dodecafluoro-4-(1,1,2,2,2-pentafluoroethyl)hexyl]phosphonic acid.
| Compound Name | [1,1,2,2,3,3,4,5,5,6,6,6-dodecafluoro-4-(1,1,2,2,2-pentafluoroethyl)hexyl]phosphonic acid |
|---|---|
| PubChem CID | 87155338 |
| Molecular Formula | C8H2F17O3P |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.95 |
| IUPAC Name | [1,1,2,2,3,3,4,5,5,6,6,6-dodecafluoro-4-(1,1,2,2,2-pentafluoroethyl)hexyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F17O3P/c9-1(3(12,13)6(18,19)20,4(14,15)7(21,22)23)2(10,11)5(16,17)8(24,25)29(26,27)28/h(H2,26,27,28) |
| InChIKey | OXKCEPJQGSHNLC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|