C2H2ClF4O3P — CID 163324645
(2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid (PubChem CID 163324645) has the molecular formula C2H2ClF4O3P and a molecular weight of 216.45 g/mol. Its IUPAC name is (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid.
| Compound Name | (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid |
|---|---|
| PubChem CID | 163324645 |
| Molecular Formula | C2H2ClF4O3P |
| Molecular Weight | 216.45 g/mol |
| Exact Mass | 215.94 |
| IUPAC Name | (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C2H2ClF4O3P/c3-1(4,5)2(6,7)11(8,9)10/h(H2,8,9,10) |
| InChIKey | SUFBOCQXINFMGT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|