(2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid

C2H2ClF4O3P — CID 163324645

IUPAC(2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid
SMILESO=P(O)(O)C(F)(F)C(F)(F)Cl
InChIInChI=1S/C2H2ClF4O3P/c3-1(4,5)2(6,7)11(8,9)10/h(H2,8,9,10)
InChIKeySUFBOCQXINFMGT-UHFFFAOYSA-N
MW216.45 g/mol
LogP1.59
Rot. Bonds2

About (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid

(2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid (PubChem CID 163324645) has the molecular formula C2H2ClF4O3P and a molecular weight of 216.45 g/mol. Its IUPAC name is (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid.

Molecular Properties

Compound Name(2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid
PubChem CID163324645
Molecular FormulaC2H2ClF4O3P
Molecular Weight216.45 g/mol
Exact Mass215.94
IUPAC Name(2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid
SMILESO=P(O)(O)C(F)(F)C(F)(F)Cl
InChIInChI=1S/C2H2ClF4O3P/c3-1(4,5)2(6,7)11(8,9)10/h(H2,8,9,10)
InChIKeySUFBOCQXINFMGT-UHFFFAOYSA-N
XLogP1.59
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.45
LogP ≤ 51.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid?
The IUPAC name of (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid (CID 163324645) is (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid.
What is the SMILES notation for (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid?
The canonical SMILES for (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid is O=P(O)(O)C(F)(F)C(F)(F)Cl.
What is the InChIKey of (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid?
The InChIKey is SUFBOCQXINFMGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2ClF4O3P/c3-1(4,5)2(6,7)11(8,9)10/h(H2,8,9,10).
What are the key properties of (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid?
(2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid has a molecular weight of 216.45 g/mol, XLogP of 1.59, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1,1,2,2-tetrafluoroethyl)phosphonic acid is sourced from PubChem (CID 163324645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).