C2H5F4O8P3 — CID 102047871
[[[difluoro(phosphono)methyl]-hydroxyphosphoryl]-difluoromethyl]phosphonic acid (PubChem CID 102047871) has the molecular formula C2H5F4O8P3 and a molecular weight of 325.97 g/mol. Its IUPAC name is [[[difluoro(phosphono)methyl]-hydroxyphosphoryl]-difluoromethyl]phosphonic acid.
| Compound Name | [[[difluoro(phosphono)methyl]-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 102047871 |
| Molecular Formula | C2H5F4O8P3 |
| Molecular Weight | 325.97 g/mol |
| Exact Mass | 325.91 |
| IUPAC Name | [[[difluoro(phosphono)methyl]-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)P(=O)(O)C(F)(F)P(=O)(O)O |
| InChI | InChI=1S/C2H5F4O8P3/c3-1(4,16(9,10)11)15(7,8)2(5,6)17(12,13)14/h(H,7,8)(H2,9,10,11)(H2,12,13,14) |
| InChIKey | DOZYWAZXPHUYAL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.97 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|