CH4F2O9P2S — CID 87348536
[difluoro-[hydroxy(sulfooxy)phosphoryl]methyl]phosphonic acid (PubChem CID 87348536) has the molecular formula CH4F2O9P2S and a molecular weight of 292.05 g/mol. Its IUPAC name is [difluoro-[hydroxy(sulfooxy)phosphoryl]methyl]phosphonic acid.
| Compound Name | [difluoro-[hydroxy(sulfooxy)phosphoryl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 87348536 |
| Molecular Formula | CH4F2O9P2S |
| Molecular Weight | 292.05 g/mol |
| Exact Mass | 291.90 |
| IUPAC Name | [difluoro-[hydroxy(sulfooxy)phosphoryl]methyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)P(=O)(O)OS(=O)(=O)O |
| InChI | InChI=1S/CH4F2O9P2S/c2-1(3,13(4,5)6)14(7,8)12-15(9,10)11/h(H,7,8)(H2,4,5,6)(H,9,10,11) |
| InChIKey | PCPCZUJPAZQFJG-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.05 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|