C6HF12O2P — CID 121284333
1,1,2,2,3,3,4,4,4-nonafluorobutyl(1,2,2-trifluoroethenyl)phosphinic acid (PubChem CID 121284333) has the molecular formula C6HF12O2P and a molecular weight of 364.02 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutyl(1,2,2-trifluoroethenyl)phosphinic acid.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutyl(1,2,2-trifluoroethenyl)phosphinic acid |
|---|---|
| PubChem CID | 121284333 |
| Molecular Formula | C6HF12O2P |
| Molecular Weight | 364.02 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutyl(1,2,2-trifluoroethenyl)phosphinic acid |
| SMILES | O=P(O)(C(F)=C(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF12O2P/c7-1(8)2(9)21(19,20)6(17,18)4(12,13)3(10,11)5(14,15)16/h(H,19,20) |
| InChIKey | WMIIYKLOVWSMFM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.02 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|