C9H20F5O4PSi2 — CID 87637334
[2,2,3,3,3-pentafluoro-1,1-bis(trimethylsilyl)propyl] dihydrogen phosphate (PubChem CID 87637334) has the molecular formula C9H20F5O4PSi2 and a molecular weight of 374.39 g/mol. Its IUPAC name is [2,2,3,3,3-pentafluoro-1,1-bis(trimethylsilyl)propyl] dihydrogen phosphate.
| Compound Name | [2,2,3,3,3-pentafluoro-1,1-bis(trimethylsilyl)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87637334 |
| Molecular Formula | C9H20F5O4PSi2 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | [2,2,3,3,3-pentafluoro-1,1-bis(trimethylsilyl)propyl] dihydrogen phosphate |
| SMILES | C[Si](C)(C)C(OP(=O)(O)O)(C(F)(F)C(F)(F)F)[Si](C)(C)C |
| InChI | InChI=1S/C9H20F5O4PSi2/c1-20(2,3)9(21(4,5)6,18-19(15,16)17)7(10,11)8(12,13)14/h1-6H3,(H2,15,16,17) |
| InChIKey | ZYKNEXYERATFLB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|