C8H20Cl3O4PSi2 — CID 87637440
[1,1,2-trichloro-2,2-bis(trimethylsilyl)ethyl] dihydrogen phosphate (PubChem CID 87637440) has the molecular formula C8H20Cl3O4PSi2 and a molecular weight of 373.75 g/mol. Its IUPAC name is [1,1,2-trichloro-2,2-bis(trimethylsilyl)ethyl] dihydrogen phosphate.
| Compound Name | [1,1,2-trichloro-2,2-bis(trimethylsilyl)ethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87637440 |
| Molecular Formula | C8H20Cl3O4PSi2 |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | [1,1,2-trichloro-2,2-bis(trimethylsilyl)ethyl] dihydrogen phosphate |
| SMILES | C[Si](C)(C)C(Cl)(C(Cl)(Cl)OP(=O)(O)O)[Si](C)(C)C |
| InChI | InChI=1S/C8H20Cl3O4PSi2/c1-17(2,3)8(11,18(4,5)6)7(9,10)15-16(12,13)14/h1-6H3,(H2,12,13,14) |
| InChIKey | VVZIXVYEXKIAKW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|