C5H7Cl6O4P — CID 175190839
(1,1,1,2,3,4-hexachloro-3-methylbutan-2-yl) dihydrogen phosphate (PubChem CID 175190839) has the molecular formula C5H7Cl6O4P and a molecular weight of 374.80 g/mol. Its IUPAC name is (1,1,1,2,3,4-hexachloro-3-methylbutan-2-yl) dihydrogen phosphate.
| Compound Name | (1,1,1,2,3,4-hexachloro-3-methylbutan-2-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 175190839 |
| Molecular Formula | C5H7Cl6O4P |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 371.82 |
| IUPAC Name | (1,1,1,2,3,4-hexachloro-3-methylbutan-2-yl) dihydrogen phosphate |
| SMILES | CC(Cl)(CCl)C(Cl)(OP(=O)(O)O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H7Cl6O4P/c1-3(7,2-6)4(8,5(9,10)11)15-16(12,13)14/h2H2,1H3,(H2,12,13,14) |
| InChIKey | GTFAJBRQTBTDLA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|