C6H16NaO6P — CID 175400534
sodium;1,1-diethoxyethyl dihydrogen phosphate;hydride (PubChem CID 175400534) has the molecular formula C6H16NaO6P and a molecular weight of 238.15 g/mol. Its IUPAC name is sodium;1,1-diethoxyethyl dihydrogen phosphate;hydride.
| Compound Name | sodium;1,1-diethoxyethyl dihydrogen phosphate;hydride |
|---|---|
| PubChem CID | 175400534 |
| Molecular Formula | C6H16NaO6P |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | sodium;1,1-diethoxyethyl dihydrogen phosphate;hydride |
| SMILES | CCOC(C)(OCC)OP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C6H15O6P.Na.H/c1-4-10-6(3,11-5-2)12-13(7,8)9;;/h4-5H2,1-3H3,(H2,7,8,9);;/q;+1;-1 |
| InChIKey | ZTOOPSWVQZNYRH-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|