C11H19O13P — CID 146462683
[1,2-bis(ethoxycarbonyloxy)-1-phosphonooxyethyl] ethyl carbonate (PubChem CID 146462683) has the molecular formula C11H19O13P and a molecular weight of 390.23 g/mol. Its IUPAC name is [1,2-bis(ethoxycarbonyloxy)-1-phosphonooxyethyl] ethyl carbonate.
| Compound Name | [1,2-bis(ethoxycarbonyloxy)-1-phosphonooxyethyl] ethyl carbonate |
|---|---|
| PubChem CID | 146462683 |
| Molecular Formula | C11H19O13P |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | [1,2-bis(ethoxycarbonyloxy)-1-phosphonooxyethyl] ethyl carbonate |
| SMILES | CCOC(=O)OCC(OC(=O)OCC)(OC(=O)OCC)OP(=O)(O)O |
| InChI | InChI=1S/C11H19O13P/c1-4-18-8(12)21-7-11(24-25(15,16)17,22-9(13)19-5-2)23-10(14)20-6-3/h4-7H2,1-3H3,(H2,15,16,17) |
| InChIKey | RZQAAIJTBCAPGP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 173.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|